C19H14Cl2N2O — CID 54784944
2-anilino-N-(3,5-dichlorophenyl)benzamide (PubChem CID 54784944) has the molecular formula C19H14Cl2N2O and a molecular weight of 357.24 g/mol. Its IUPAC name is 2-anilino-N-(3,5-dichlorophenyl)benzamide.
| Compound Name | 2-anilino-N-(3,5-dichlorophenyl)benzamide |
|---|---|
| PubChem CID | 54784944 |
| Molecular Formula | C19H14Cl2N2O |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 2-anilino-N-(3,5-dichlorophenyl)benzamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)c1ccccc1Nc1ccccc1 |
| InChI | InChI=1S/C19H14Cl2N2O/c20-13-10-14(21)12-16(11-13)23-19(24)17-8-4-5-9-18(17)22-15-6-2-1-3-7-15/h1-12,22H,(H,23,24) |
| InChIKey | NSYVQFVBFXLIQT-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |