C20H14Cl2N2O2 — CID 17133465
3,5-dichloro-N-[2-(phenylcarbamoyl)phenyl]benzamide (PubChem CID 17133465) has the molecular formula C20H14Cl2N2O2 and a molecular weight of 385.25 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-(phenylcarbamoyl)phenyl]benzamide.
| Compound Name | 3,5-dichloro-N-[2-(phenylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 17133465 |
| Molecular Formula | C20H14Cl2N2O2 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 3,5-dichloro-N-[2-(phenylcarbamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)Nc1ccccc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H14Cl2N2O2/c21-14-10-13(11-15(22)12-14)19(25)24-18-9-5-4-8-17(18)20(26)23-16-6-2-1-3-7-16/h1-12H,(H,23,26)(H,24,25) |
| InChIKey | MSRWQZJASRPKHT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |