C20H15Cl2N3O2 — CID 10971378
3,5-dichloro-N-[3-(phenylcarbamoylamino)phenyl]benzamide (PubChem CID 10971378) has the molecular formula C20H15Cl2N3O2 and a molecular weight of 400.27 g/mol. Its IUPAC name is 3,5-dichloro-N-[3-(phenylcarbamoylamino)phenyl]benzamide.
| Compound Name | 3,5-dichloro-N-[3-(phenylcarbamoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 10971378 |
| Molecular Formula | C20H15Cl2N3O2 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 3,5-dichloro-N-[3-(phenylcarbamoylamino)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1)Nc1cccc(NC(=O)c2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C20H15Cl2N3O2/c21-14-9-13(10-15(22)11-14)19(26)23-17-7-4-8-18(12-17)25-20(27)24-16-5-2-1-3-6-16/h1-12H,(H,23,26)(H2,24,25,27) |
| InChIKey | SVWKENWRMBXWBG-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |