C27H22N4O3 — CID 71601154
2-amino-N-[2-[[2-(phenylcarbamoyl)phenyl]carbamoyl]phenyl]benzamide (PubChem CID 71601154) has the molecular formula C27H22N4O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is 2-amino-N-[2-[[2-(phenylcarbamoyl)phenyl]carbamoyl]phenyl]benzamide.
| Compound Name | 2-amino-N-[2-[[2-(phenylcarbamoyl)phenyl]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 71601154 |
| Molecular Formula | C27H22N4O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 2-amino-N-[2-[[2-(phenylcarbamoyl)phenyl]carbamoyl]phenyl]benzamide |
| SMILES | Nc1ccccc1C(=O)Nc1ccccc1C(=O)Nc1ccccc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C27H22N4O3/c28-22-15-7-4-12-19(22)25(32)30-24-17-9-6-14-21(24)27(34)31-23-16-8-5-13-20(23)26(33)29-18-10-2-1-3-11-18/h1-17H,28H2,(H,29,33)(H,30,32)(H,31,34) |
| InChIKey | YLYSHUHGJNCRCX-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|