C16H15N3O4 — CID 10686637
2-[[2-[(2-aminobenzoyl)amino]benzoyl]amino]acetic acid (PubChem CID 10686637) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is 2-[[2-[(2-aminobenzoyl)amino]benzoyl]amino]acetic acid.
| Compound Name | 2-[[2-[(2-aminobenzoyl)amino]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 10686637 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-[[2-[(2-aminobenzoyl)amino]benzoyl]amino]acetic acid |
| SMILES | Nc1ccccc1C(=O)Nc1ccccc1C(=O)NCC(=O)O |
| InChI | InChI=1S/C16H15N3O4/c17-12-7-3-1-5-10(12)16(23)19-13-8-4-2-6-11(13)15(22)18-9-14(20)21/h1-8H,9,17H2,(H,18,22)(H,19,23)(H,20,21) |
| InChIKey | GJSZVBSXKWDCLO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|