C17H16N2O4 — CID 4949321
2-[[2-(ethylcarbamoyl)phenyl]carbamoyl]benzoic acid (PubChem CID 4949321) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is 2-[[2-(ethylcarbamoyl)phenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[2-(ethylcarbamoyl)phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 4949321 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-[[2-(ethylcarbamoyl)phenyl]carbamoyl]benzoic acid |
| SMILES | CCNC(=O)c1ccccc1NC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C17H16N2O4/c1-2-18-15(20)13-9-5-6-10-14(13)19-16(21)11-7-3-4-8-12(11)17(22)23/h3-10H,2H2,1H3,(H,18,20)(H,19,21)(H,22,23) |
| InChIKey | FATQKQVQOCXOHM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |