2-[(2-acetylbenzoyl)amino]benzoic acid

C16H13NO4 — CID 71162267

IUPAC2-[(2-acetylbenzoyl)amino]benzoic acid
SMILESCC(=O)c1ccccc1C(=O)Nc1ccccc1C(=O)O
InChIInChI=1S/C16H13NO4/c1-10(18)11-6-2-3-7-12(11)15(19)17-14-9-5-4-8-13(14)16(20)21/h2-9H,1H3,(H,17,19)(H,20,21)
InChIKeyOVNPSVJPJJGZMC-UHFFFAOYSA-N
MW283.28 g/mol
LogP2.84
Rot. Bonds4

About 2-[(2-acetylbenzoyl)amino]benzoic acid

2-[(2-acetylbenzoyl)amino]benzoic acid (PubChem CID 71162267) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is 2-[(2-acetylbenzoyl)amino]benzoic acid.

Molecular Properties

Compound Name2-[(2-acetylbenzoyl)amino]benzoic acid
PubChem CID71162267
Molecular FormulaC16H13NO4
Molecular Weight283.28 g/mol
Exact Mass283.08
IUPAC Name2-[(2-acetylbenzoyl)amino]benzoic acid
SMILESCC(=O)c1ccccc1C(=O)Nc1ccccc1C(=O)O
InChIInChI=1S/C16H13NO4/c1-10(18)11-6-2-3-7-12(11)15(19)17-14-9-5-4-8-13(14)16(20)21/h2-9H,1H3,(H,17,19)(H,20,21)
InChIKeyOVNPSVJPJJGZMC-UHFFFAOYSA-N
XLogP2.84
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.28
LogP ≤ 52.84
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[(2-acetylbenzoyl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[[2-(methylamino)benzoyl]amino]benzoic acid
CID 12819847
2-[[2-(phenylcarbamoyl)phenyl]carbamoyl]benzoic acid
CID 1008649
CID 170843062
CID 170843062
2-[[2-(ethylamino)benzoyl]amino]benzoic acid
CID 14221255
2-[[2-[(4-fluorophenyl)carbamoyl]phenyl]carbamoyl]benzoic acid
CID 982173
2-[[2-(ethylcarbamoyl)phenyl]carbamoyl]benzoic acid
CID 4949321
2-acetyl-N-(4-hydroxyphenyl)benzamide
CID 71011787
2-[(2,6-dimethylbenzoyl)amino]benzoic acid
CID 107999955
ethane;2-[(4-hydroxybenzoyl)amino]benzoic acid
CID 143368686
2-[[2-[(2-phenylacetyl)amino]benzoyl]amino]benzoic acid
CID 54761803
2-[(2-methoxyphenyl)carbamoyl]benzoic acid
CID 762850
2-[(3,5-dimethylbenzoyl)amino]benzoic acid
CID 16771715

Frequently Asked Questions

What is the IUPAC name of 2-[(2-acetylbenzoyl)amino]benzoic acid?
The IUPAC name of 2-[(2-acetylbenzoyl)amino]benzoic acid (CID 71162267) is 2-[(2-acetylbenzoyl)amino]benzoic acid.
What is the SMILES notation for 2-[(2-acetylbenzoyl)amino]benzoic acid?
The canonical SMILES for 2-[(2-acetylbenzoyl)amino]benzoic acid is CC(=O)c1ccccc1C(=O)Nc1ccccc1C(=O)O.
What is the InChIKey of 2-[(2-acetylbenzoyl)amino]benzoic acid?
The InChIKey is OVNPSVJPJJGZMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO4/c1-10(18)11-6-2-3-7-12(11)15(19)17-14-9-5-4-8-13(14)16(20)21/h2-9H,1H3,(H,17,19)(H,20,21).
What are the key properties of 2-[(2-acetylbenzoyl)amino]benzoic acid?
2-[(2-acetylbenzoyl)amino]benzoic acid has a molecular weight of 283.28 g/mol, XLogP of 2.84, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-acetylbenzoyl)amino]benzoic acid is sourced from PubChem (CID 71162267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).