C13H17NO4 — CID 90945559
2-(ethylcarbamoyl)benzoic acid;propan-2-one (PubChem CID 90945559) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 2-(ethylcarbamoyl)benzoic acid;propan-2-one.
| Compound Name | 2-(ethylcarbamoyl)benzoic acid;propan-2-one |
|---|---|
| PubChem CID | 90945559 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 2-(ethylcarbamoyl)benzoic acid;propan-2-one |
| SMILES | CC(C)=O.CCNC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C10H11NO3.C3H6O/c1-2-11-9(12)7-5-3-4-6-8(7)10(13)14;1-3(2)4/h3-6H,2H2,1H3,(H,11,12)(H,13,14);1-2H3 |
| InChIKey | YYEKNCPDEFHMHX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |