C24H30N4O4 — CID 4866653
2-[2,6-bis(ethylcarbamoyl)phenyl]-1-N,3-N-diethylbenzene-1,3-dicarboxamide (PubChem CID 4866653) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 2-[2,6-bis(ethylcarbamoyl)phenyl]-1-N,3-N-diethylbenzene-1,3-dicarboxamide.
| Compound Name | 2-[2,6-bis(ethylcarbamoyl)phenyl]-1-N,3-N-diethylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 4866653 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 2-[2,6-bis(ethylcarbamoyl)phenyl]-1-N,3-N-diethylbenzene-1,3-dicarboxamide |
| SMILES | CCNC(=O)c1cccc(C(=O)NCC)c1-c1c(C(=O)NCC)cccc1C(=O)NCC |
| InChI | InChI=1S/C24H30N4O4/c1-5-25-21(29)15-11-9-12-16(22(30)26-6-2)19(15)20-17(23(31)27-7-3)13-10-14-18(20)24(32)28-8-4/h9-14H,5-8H2,1-4H3,(H,25,29)(H,26,30)(H,27,31)(H,28,32) |
| InChIKey | OEYSAFHPULDBKH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |