C18H27NO — CID 144944456
ethane;N-ethylnaphthalene-1-carboxamide;propane (PubChem CID 144944456) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is ethane;N-ethylnaphthalene-1-carboxamide;propane.
| Compound Name | ethane;N-ethylnaphthalene-1-carboxamide;propane |
|---|---|
| PubChem CID | 144944456 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | ethane;N-ethylnaphthalene-1-carboxamide;propane |
| SMILES | CC.CCC.CCNC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C13H13NO.C3H8.C2H6/c1-2-14-13(15)12-9-5-7-10-6-3-4-8-11(10)12;1-3-2;1-2/h3-9H,2H2,1H3,(H,14,15);3H2,1-2H3;1-2H3 |
| InChIKey | IHXQPIWFNGTGPP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |