C13H14N2O3S — CID 61067529
N-(2-sulfamoylethyl)naphthalene-1-carboxamide (PubChem CID 61067529) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is N-(2-sulfamoylethyl)naphthalene-1-carboxamide.
| Compound Name | N-(2-sulfamoylethyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 61067529 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | N-(2-sulfamoylethyl)naphthalene-1-carboxamide |
| SMILES | NS(=O)(=O)CCNC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C13H14N2O3S/c14-19(17,18)9-8-15-13(16)12-7-3-5-10-4-1-2-6-11(10)12/h1-7H,8-9H2,(H,15,16)(H2,14,17,18) |
| InChIKey | AWHNPEYMAOZFDU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |