C9H11N3O6S — CID 103800076
2-hydroxy-3-nitro-N-(2-sulfamoylethyl)benzamide (PubChem CID 103800076) has the molecular formula C9H11N3O6S and a molecular weight of 289.27 g/mol. Its IUPAC name is 2-hydroxy-3-nitro-N-(2-sulfamoylethyl)benzamide.
| Compound Name | 2-hydroxy-3-nitro-N-(2-sulfamoylethyl)benzamide |
|---|---|
| PubChem CID | 103800076 |
| Molecular Formula | C9H11N3O6S |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 2-hydroxy-3-nitro-N-(2-sulfamoylethyl)benzamide |
| SMILES | NS(=O)(=O)CCNC(=O)c1cccc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C9H11N3O6S/c10-19(17,18)5-4-11-9(14)6-2-1-3-7(8(6)13)12(15)16/h1-3,13H,4-5H2,(H,11,14)(H2,10,17,18) |
| InChIKey | SXPYGLJSJUSICM-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 152.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|