C9H12N4O5S — CID 112699109
2-amino-3-nitro-N-(2-sulfamoylethyl)benzamide (PubChem CID 112699109) has the molecular formula C9H12N4O5S and a molecular weight of 288.28 g/mol. Its IUPAC name is 2-amino-3-nitro-N-(2-sulfamoylethyl)benzamide.
| Compound Name | 2-amino-3-nitro-N-(2-sulfamoylethyl)benzamide |
|---|---|
| PubChem CID | 112699109 |
| Molecular Formula | C9H12N4O5S |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 2-amino-3-nitro-N-(2-sulfamoylethyl)benzamide |
| SMILES | Nc1c(C(=O)NCCS(N)(=O)=O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12N4O5S/c10-8-6(2-1-3-7(8)13(15)16)9(14)12-4-5-19(11,17)18/h1-3H,4-5,10H2,(H,12,14)(H2,11,17,18) |
| InChIKey | LTSWWIDJBGQJRB-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 158.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|