C13H14N4O4 — CID 107076623
2-hydroxy-N-[3-(1H-imidazol-2-yl)propyl]-3-nitrobenzamide (PubChem CID 107076623) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-hydroxy-N-[3-(1H-imidazol-2-yl)propyl]-3-nitrobenzamide.
| Compound Name | 2-hydroxy-N-[3-(1H-imidazol-2-yl)propyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 107076623 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-hydroxy-N-[3-(1H-imidazol-2-yl)propyl]-3-nitrobenzamide |
| SMILES | O=C(NCCCc1ncc[nH]1)c1cccc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C13H14N4O4/c18-12-9(3-1-4-10(12)17(20)21)13(19)16-6-2-5-11-14-7-8-15-11/h1,3-4,7-8,18H,2,5-6H2,(H,14,15)(H,16,19) |
| InChIKey | HLSLWVJVPVDKDN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|