C11H9N3O4S — CID 103800073
2-hydroxy-3-nitro-N-(1,3-thiazol-2-ylmethyl)benzamide (PubChem CID 103800073) has the molecular formula C11H9N3O4S and a molecular weight of 279.28 g/mol. Its IUPAC name is 2-hydroxy-3-nitro-N-(1,3-thiazol-2-ylmethyl)benzamide.
| Compound Name | 2-hydroxy-3-nitro-N-(1,3-thiazol-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 103800073 |
| Molecular Formula | C11H9N3O4S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 2-hydroxy-3-nitro-N-(1,3-thiazol-2-ylmethyl)benzamide |
| SMILES | O=C(NCc1nccs1)c1cccc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C11H9N3O4S/c15-10-7(2-1-3-8(10)14(17)18)11(16)13-6-9-12-4-5-19-9/h1-5,15H,6H2,(H,13,16) |
| InChIKey | OQAIDTZHSDOAMS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|