C11H10N2OS2 — CID 107025613
2-sulfanyl-N-(1,3-thiazol-2-ylmethyl)benzamide (PubChem CID 107025613) has the molecular formula C11H10N2OS2 and a molecular weight of 250.35 g/mol. Its IUPAC name is 2-sulfanyl-N-(1,3-thiazol-2-ylmethyl)benzamide.
| Compound Name | 2-sulfanyl-N-(1,3-thiazol-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 107025613 |
| Molecular Formula | C11H10N2OS2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 2-sulfanyl-N-(1,3-thiazol-2-ylmethyl)benzamide |
| SMILES | O=C(NCc1nccs1)c1ccccc1S |
| InChI | InChI=1S/C11H10N2OS2/c14-11(8-3-1-2-4-9(8)15)13-7-10-12-5-6-16-10/h1-6,15H,7H2,(H,13,14) |
| InChIKey | UOBIDIBYCRPISQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|