C11H10N2O2S — CID 106423406
N-(1,2-oxazol-5-ylmethyl)-2-sulfanylbenzamide (PubChem CID 106423406) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is N-(1,2-oxazol-5-ylmethyl)-2-sulfanylbenzamide.
| Compound Name | N-(1,2-oxazol-5-ylmethyl)-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 106423406 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | N-(1,2-oxazol-5-ylmethyl)-2-sulfanylbenzamide |
| SMILES | O=C(NCc1ccno1)c1ccccc1S |
| InChI | InChI=1S/C11H10N2O2S/c14-11(9-3-1-2-4-10(9)16)12-7-8-5-6-13-15-8/h1-6,16H,7H2,(H,12,14) |
| InChIKey | QEIXCIYNMCQRSJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|