C10H8ClN3O2 — CID 104600464
2-chloro-N-(1,2-oxazol-5-ylmethyl)pyridine-3-carboxamide (PubChem CID 104600464) has the molecular formula C10H8ClN3O2 and a molecular weight of 237.65 g/mol. Its IUPAC name is 2-chloro-N-(1,2-oxazol-5-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(1,2-oxazol-5-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 104600464 |
| Molecular Formula | C10H8ClN3O2 |
| Molecular Weight | 237.65 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 2-chloro-N-(1,2-oxazol-5-ylmethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccno1)c1cccnc1Cl |
| InChI | InChI=1S/C10H8ClN3O2/c11-9-8(2-1-4-12-9)10(15)13-6-7-3-5-14-16-7/h1-5H,6H2,(H,13,15) |
| InChIKey | KEALZWHJNJTQDM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.65 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|