C9H7ClN4O2 — CID 106396006
2-chloro-N-(1,2,4-oxadiazol-3-ylmethyl)pyridine-3-carboxamide (PubChem CID 106396006) has the molecular formula C9H7ClN4O2 and a molecular weight of 238.63 g/mol. Its IUPAC name is 2-chloro-N-(1,2,4-oxadiazol-3-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(1,2,4-oxadiazol-3-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 106396006 |
| Molecular Formula | C9H7ClN4O2 |
| Molecular Weight | 238.63 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 2-chloro-N-(1,2,4-oxadiazol-3-ylmethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCc1ncon1)c1cccnc1Cl |
| InChI | InChI=1S/C9H7ClN4O2/c10-8-6(2-1-3-11-8)9(15)12-4-7-13-5-16-14-7/h1-3,5H,4H2,(H,12,15) |
| InChIKey | ZVWFZIJGLHBLSH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.63 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|