C10H9N3O4 — CID 114183968
2,3-dihydroxy-N-(1,2,4-oxadiazol-3-ylmethyl)benzamide (PubChem CID 114183968) has the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. Its IUPAC name is 2,3-dihydroxy-N-(1,2,4-oxadiazol-3-ylmethyl)benzamide.
| Compound Name | 2,3-dihydroxy-N-(1,2,4-oxadiazol-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 114183968 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2,3-dihydroxy-N-(1,2,4-oxadiazol-3-ylmethyl)benzamide |
| SMILES | O=C(NCc1ncon1)c1cccc(O)c1O |
| InChI | InChI=1S/C10H9N3O4/c14-7-3-1-2-6(9(7)15)10(16)11-4-8-12-5-17-13-8/h1-3,5,14-15H,4H2,(H,11,16) |
| InChIKey | CQXKMDPWXSDJGI-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|