C12H10N4O2 — CID 106406322
N-(1,2,4-oxadiazol-3-ylmethyl)-1H-indole-7-carboxamide (PubChem CID 106406322) has the molecular formula C12H10N4O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is N-(1,2,4-oxadiazol-3-ylmethyl)-1H-indole-7-carboxamide.
| Compound Name | N-(1,2,4-oxadiazol-3-ylmethyl)-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 106406322 |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | N-(1,2,4-oxadiazol-3-ylmethyl)-1H-indole-7-carboxamide |
| SMILES | O=C(NCc1ncon1)c1cccc2cc[nH]c12 |
| InChI | InChI=1S/C12H10N4O2/c17-12(14-6-10-15-7-18-16-10)9-3-1-2-8-4-5-13-11(8)9/h1-5,7,13H,6H2,(H,14,17) |
| InChIKey | IJYJKSJNKJOHAS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |