C12H13N3O2 — CID 106420098
2-(methylamino)-N-(1,2-oxazol-5-ylmethyl)benzamide (PubChem CID 106420098) has the molecular formula C12H13N3O2 and a molecular weight of 231.26 g/mol. Its IUPAC name is 2-(methylamino)-N-(1,2-oxazol-5-ylmethyl)benzamide.
| Compound Name | 2-(methylamino)-N-(1,2-oxazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 106420098 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 2-(methylamino)-N-(1,2-oxazol-5-ylmethyl)benzamide |
| SMILES | CNc1ccccc1C(=O)NCc1ccno1 |
| InChI | InChI=1S/C12H13N3O2/c1-13-11-5-3-2-4-10(11)12(16)14-8-9-6-7-15-17-9/h2-7,13H,8H2,1H3,(H,14,16) |
| InChIKey | OIJNERTVWKLQFM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |