C12H12N2O2S — CID 114186980
2-methyl-N-(1,2-oxazol-5-ylmethyl)-5-sulfanylbenzamide (PubChem CID 114186980) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 2-methyl-N-(1,2-oxazol-5-ylmethyl)-5-sulfanylbenzamide.
| Compound Name | 2-methyl-N-(1,2-oxazol-5-ylmethyl)-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 114186980 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2-methyl-N-(1,2-oxazol-5-ylmethyl)-5-sulfanylbenzamide |
| SMILES | Cc1ccc(S)cc1C(=O)NCc1ccno1 |
| InChI | InChI=1S/C12H12N2O2S/c1-8-2-3-10(17)6-11(8)12(15)13-7-9-4-5-14-16-9/h2-6,17H,7H2,1H3,(H,13,15) |
| InChIKey | FHTGHHDJAQGKIN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|