C10H8FN3O2 — CID 104600458
3-fluoro-N-(1,2-oxazol-5-ylmethyl)pyridine-4-carboxamide (PubChem CID 104600458) has the molecular formula C10H8FN3O2 and a molecular weight of 221.19 g/mol. Its IUPAC name is 3-fluoro-N-(1,2-oxazol-5-ylmethyl)pyridine-4-carboxamide.
| Compound Name | 3-fluoro-N-(1,2-oxazol-5-ylmethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 104600458 |
| Molecular Formula | C10H8FN3O2 |
| Molecular Weight | 221.19 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 3-fluoro-N-(1,2-oxazol-5-ylmethyl)pyridine-4-carboxamide |
| SMILES | O=C(NCc1ccno1)c1ccncc1F |
| InChI | InChI=1S/C10H8FN3O2/c11-9-6-12-3-2-8(9)10(15)13-5-7-1-4-14-16-7/h1-4,6H,5H2,(H,13,15) |
| InChIKey | CUQUCVTUVMEEBI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.19 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |