C14H13FN2O4 — CID 71976284
ethyl 5-[[(3-fluoropyridine-4-carbonyl)amino]methyl]furan-2-carboxylate (PubChem CID 71976284) has the molecular formula C14H13FN2O4 and a molecular weight of 292.27 g/mol. Its IUPAC name is ethyl 5-[[(3-fluoropyridine-4-carbonyl)amino]methyl]furan-2-carboxylate.
| Compound Name | ethyl 5-[[(3-fluoropyridine-4-carbonyl)amino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 71976284 |
| Molecular Formula | C14H13FN2O4 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | ethyl 5-[[(3-fluoropyridine-4-carbonyl)amino]methyl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(CNC(=O)c2ccncc2F)o1 |
| InChI | InChI=1S/C14H13FN2O4/c1-2-20-14(19)12-4-3-9(21-12)7-17-13(18)10-5-6-16-8-11(10)15/h3-6,8H,2,7H2,1H3,(H,17,18) |
| InChIKey | FIYZJXKOGQHTGP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |