C11H17NO4 — CID 115904417
ethyl 5-[(2-methoxyethylamino)methyl]furan-2-carboxylate (PubChem CID 115904417) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is ethyl 5-[(2-methoxyethylamino)methyl]furan-2-carboxylate.
| Compound Name | ethyl 5-[(2-methoxyethylamino)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 115904417 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | ethyl 5-[(2-methoxyethylamino)methyl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(CNCCOC)o1 |
| InChI | InChI=1S/C11H17NO4/c1-3-15-11(13)10-5-4-9(16-10)8-12-6-7-14-2/h4-5,12H,3,6-8H2,1-2H3 |
| InChIKey | NCMWEQORBHFTAS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|