C13H12BrNO5 — CID 71976281
ethyl 5-[[(5-bromofuran-2-carbonyl)amino]methyl]furan-2-carboxylate (PubChem CID 71976281) has the molecular formula C13H12BrNO5 and a molecular weight of 342.15 g/mol. Its IUPAC name is ethyl 5-[[(5-bromofuran-2-carbonyl)amino]methyl]furan-2-carboxylate.
| Compound Name | ethyl 5-[[(5-bromofuran-2-carbonyl)amino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 71976281 |
| Molecular Formula | C13H12BrNO5 |
| Molecular Weight | 342.15 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | ethyl 5-[[(5-bromofuran-2-carbonyl)amino]methyl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(CNC(=O)c2ccc(Br)o2)o1 |
| InChI | InChI=1S/C13H12BrNO5/c1-2-18-13(17)10-4-3-8(19-10)7-15-12(16)9-5-6-11(14)20-9/h3-6H,2,7H2,1H3,(H,15,16) |
| InChIKey | BZDNBXJBOQPSCW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 81.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.15 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |