C14H13ClN2O4 — CID 84586320
ethyl 5-[[(5-chloropyridine-2-carbonyl)amino]methyl]furan-2-carboxylate (PubChem CID 84586320) has the molecular formula C14H13ClN2O4 and a molecular weight of 308.72 g/mol. Its IUPAC name is ethyl 5-[[(5-chloropyridine-2-carbonyl)amino]methyl]furan-2-carboxylate.
| Compound Name | ethyl 5-[[(5-chloropyridine-2-carbonyl)amino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 84586320 |
| Molecular Formula | C14H13ClN2O4 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | ethyl 5-[[(5-chloropyridine-2-carbonyl)amino]methyl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(CNC(=O)c2ccc(Cl)cn2)o1 |
| InChI | InChI=1S/C14H13ClN2O4/c1-2-20-14(19)12-6-4-10(21-12)8-17-13(18)11-5-3-9(15)7-16-11/h3-7H,2,8H2,1H3,(H,17,18) |
| InChIKey | NBXUVQAQRYFTDB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |