C16H15N3O4 — CID 71976298
ethyl 5-[(1H-indazole-3-carbonylamino)methyl]furan-2-carboxylate (PubChem CID 71976298) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is ethyl 5-[(1H-indazole-3-carbonylamino)methyl]furan-2-carboxylate.
| Compound Name | ethyl 5-[(1H-indazole-3-carbonylamino)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 71976298 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | ethyl 5-[(1H-indazole-3-carbonylamino)methyl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(CNC(=O)c2n[nH]c3ccccc23)o1 |
| InChI | InChI=1S/C16H15N3O4/c1-2-22-16(21)13-8-7-10(23-13)9-17-15(20)14-11-5-3-4-6-12(11)18-19-14/h3-8H,2,9H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | LINVAFXJDNZGQI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |