C12H17NO4 — CID 71976282
ethyl 5-[(2-methylpropanoylamino)methyl]furan-2-carboxylate (PubChem CID 71976282) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is ethyl 5-[(2-methylpropanoylamino)methyl]furan-2-carboxylate.
| Compound Name | ethyl 5-[(2-methylpropanoylamino)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 71976282 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | ethyl 5-[(2-methylpropanoylamino)methyl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(CNC(=O)C(C)C)o1 |
| InChI | InChI=1S/C12H17NO4/c1-4-16-12(15)10-6-5-9(17-10)7-13-11(14)8(2)3/h5-6,8H,4,7H2,1-3H3,(H,13,14) |
| InChIKey | GLHYRKBNICBDLE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |