C19H20N4O4 — CID 170365162
aminomethyl 2-ethoxy-5-[(1H-indazole-3-carbonylamino)methyl]benzoate (PubChem CID 170365162) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is aminomethyl 2-ethoxy-5-[(1H-indazole-3-carbonylamino)methyl]benzoate.
| Compound Name | aminomethyl 2-ethoxy-5-[(1H-indazole-3-carbonylamino)methyl]benzoate |
|---|---|
| PubChem CID | 170365162 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | aminomethyl 2-ethoxy-5-[(1H-indazole-3-carbonylamino)methyl]benzoate |
| SMILES | CCOc1ccc(CNC(=O)c2n[nH]c3ccccc23)cc1C(=O)OCN |
| InChI | InChI=1S/C19H20N4O4/c1-2-26-16-8-7-12(9-14(16)19(25)27-11-20)10-21-18(24)17-13-5-3-4-6-15(13)22-23-17/h3-9H,2,10-11,20H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | DNGUORGSLPDFCO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|