C17H17N3O3 — CID 110899639
N-[4-ethoxy-3-(hydroxymethyl)phenyl]-1H-indazole-3-carboxamide (PubChem CID 110899639) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is N-[4-ethoxy-3-(hydroxymethyl)phenyl]-1H-indazole-3-carboxamide.
| Compound Name | N-[4-ethoxy-3-(hydroxymethyl)phenyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 110899639 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-[4-ethoxy-3-(hydroxymethyl)phenyl]-1H-indazole-3-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2n[nH]c3ccccc23)cc1CO |
| InChI | InChI=1S/C17H17N3O3/c1-2-23-15-8-7-12(9-11(15)10-21)18-17(22)16-13-5-3-4-6-14(13)19-20-16/h3-9,21H,2,10H2,1H3,(H,18,22)(H,19,20) |
| InChIKey | JFGIDBPKCIPSPI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |