C12H12ClN3O3 — CID 10379013
ethyl 5-[[(6-chloropyrazin-2-yl)amino]methyl]furan-2-carboxylate (PubChem CID 10379013) has the molecular formula C12H12ClN3O3 and a molecular weight of 281.70 g/mol. Its IUPAC name is ethyl 5-[[(6-chloropyrazin-2-yl)amino]methyl]furan-2-carboxylate.
| Compound Name | ethyl 5-[[(6-chloropyrazin-2-yl)amino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 10379013 |
| Molecular Formula | C12H12ClN3O3 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | ethyl 5-[[(6-chloropyrazin-2-yl)amino]methyl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(CNc2cncc(Cl)n2)o1 |
| InChI | InChI=1S/C12H12ClN3O3/c1-2-18-12(17)9-4-3-8(19-9)5-15-11-7-14-6-10(13)16-11/h3-4,6-7H,2,5H2,1H3,(H,15,16) |
| InChIKey | SZIODTVHFZFRQL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |