methyl 5-[[(2-ethoxy-2-oxoethyl)amino]methyl]furan-2-carboxylate

C11H15NO5 — CID 60810799

IUPACmethyl 5-[[(2-ethoxy-2-oxoethyl)amino]methyl]furan-2-carboxylate
SMILESCCOC(=O)CNCc1ccc(C(=O)OC)o1
InChIInChI=1S/C11H15NO5/c1-3-16-10(13)7-12-6-8-4-5-9(17-8)11(14)15-2/h4-5,12H,3,6-7H2,1-2H3
InChIKeySDZAEINUBFZXDR-UHFFFAOYSA-N
MW241.24 g/mol
LogP0.72
Rot. Bonds6

About methyl 5-[[(2-ethoxy-2-oxoethyl)amino]methyl]furan-2-carboxylate

methyl 5-[[(2-ethoxy-2-oxoethyl)amino]methyl]furan-2-carboxylate (PubChem CID 60810799) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is methyl 5-[[(2-ethoxy-2-oxoethyl)amino]methyl]furan-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-[[(2-ethoxy-2-oxoethyl)amino]methyl]furan-2-carboxylate
PubChem CID60810799
Molecular FormulaC11H15NO5
Molecular Weight241.24 g/mol
Exact Mass241.10
IUPAC Namemethyl 5-[[(2-ethoxy-2-oxoethyl)amino]methyl]furan-2-carboxylate
SMILESCCOC(=O)CNCc1ccc(C(=O)OC)o1
InChIInChI=1S/C11H15NO5/c1-3-16-10(13)7-12-6-8-4-5-9(17-8)11(14)15-2/h4-5,12H,3,6-7H2,1-2H3
InChIKeySDZAEINUBFZXDR-UHFFFAOYSA-N
XLogP0.72
TPSA77.77 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.24
LogP ≤ 50.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 5-[[(2-ethoxy-2-oxoethyl)amino]methyl]furan-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-[[(2-ethoxy-2-oxoethyl)amino]methyl]furan-2-carboxylate?
The IUPAC name of methyl 5-[[(2-ethoxy-2-oxoethyl)amino]methyl]furan-2-carboxylate (CID 60810799) is methyl 5-[[(2-ethoxy-2-oxoethyl)amino]methyl]furan-2-carboxylate.
What is the SMILES notation for methyl 5-[[(2-ethoxy-2-oxoethyl)amino]methyl]furan-2-carboxylate?
The canonical SMILES for methyl 5-[[(2-ethoxy-2-oxoethyl)amino]methyl]furan-2-carboxylate is CCOC(=O)CNCc1ccc(C(=O)OC)o1.
What is the InChIKey of methyl 5-[[(2-ethoxy-2-oxoethyl)amino]methyl]furan-2-carboxylate?
The InChIKey is SDZAEINUBFZXDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO5/c1-3-16-10(13)7-12-6-8-4-5-9(17-8)11(14)15-2/h4-5,12H,3,6-7H2,1-2H3.
What are the key properties of methyl 5-[[(2-ethoxy-2-oxoethyl)amino]methyl]furan-2-carboxylate?
methyl 5-[[(2-ethoxy-2-oxoethyl)amino]methyl]furan-2-carboxylate has a molecular weight of 241.24 g/mol, XLogP of 0.72, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[[(2-ethoxy-2-oxoethyl)amino]methyl]furan-2-carboxylate is sourced from PubChem (CID 60810799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).