C11H17ClNO3- — CID 53314358
methyl 5-[(butan-2-ylamino)methyl]furan-2-carboxylate chloride (PubChem CID 53314358) has the molecular formula C11H17ClNO3- and a molecular weight of 246.71 g/mol. Its IUPAC name is methyl 5-[(butan-2-ylamino)methyl]furan-2-carboxylate chloride.
| Compound Name | methyl 5-[(butan-2-ylamino)methyl]furan-2-carboxylate chloride |
|---|---|
| PubChem CID | 53314358 |
| Molecular Formula | C11H17ClNO3- |
| Molecular Weight | 246.71 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | methyl 5-[(butan-2-ylamino)methyl]furan-2-carboxylate chloride |
| SMILES | CCC(C)NCc1ccc(C(=O)OC)o1.[Cl-] |
| InChI | InChI=1S/C11H17NO3.ClH/c1-4-8(2)12-7-9-5-6-10(15-9)11(13)14-3;/h5-6,8,12H,4,7H2,1-3H3;1H/p-1 |
| InChIKey | OTYZBYXMUWLJJB-UHFFFAOYSA-M |
| XLogP | -1.04 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.71 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |