C10H15NO4 — CID 103923855
methyl 5-[[[(2R)-2-hydroxypropyl]amino]methyl]furan-2-carboxylate (PubChem CID 103923855) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is methyl 5-[[[(2R)-2-hydroxypropyl]amino]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[[(2R)-2-hydroxypropyl]amino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 103923855 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | methyl 5-[[[(2R)-2-hydroxypropyl]amino]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CNC[C@@H](C)O)o1 |
| InChI | InChI=1S/C10H15NO4/c1-7(12)5-11-6-8-3-4-9(15-8)10(13)14-2/h3-4,7,11-12H,5-6H2,1-2H3/t7-/m1/s1 |
| InChIKey | PRTFKYLNLOEPOR-SSDOTTSWSA-N |
| XLogP | 0.54 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |