C13H18N2O4 — CID 112684787
methyl 5-[[(2-oxo-2-pyrrolidin-1-ylethyl)amino]methyl]furan-2-carboxylate (PubChem CID 112684787) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is methyl 5-[[(2-oxo-2-pyrrolidin-1-ylethyl)amino]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(2-oxo-2-pyrrolidin-1-ylethyl)amino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 112684787 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | methyl 5-[[(2-oxo-2-pyrrolidin-1-ylethyl)amino]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CNCC(=O)N2CCCC2)o1 |
| InChI | InChI=1S/C13H18N2O4/c1-18-13(17)11-5-4-10(19-11)8-14-9-12(16)15-6-2-3-7-15/h4-5,14H,2-3,6-9H2,1H3 |
| InChIKey | FDUQXKRVKFUDRZ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |