C12H11FN2O3 — CID 115628469
methyl 5-[[(6-fluoro-2-pyridinyl)amino]methyl]furan-2-carboxylate (PubChem CID 115628469) has the molecular formula C12H11FN2O3 and a molecular weight of 250.23 g/mol. Its IUPAC name is methyl 5-[[(6-fluoro-2-pyridinyl)amino]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(6-fluoro-2-pyridinyl)amino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 115628469 |
| Molecular Formula | C12H11FN2O3 |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | methyl 5-[[(6-fluoro-2-pyridinyl)amino]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CNc2cccc(F)n2)o1 |
| InChI | InChI=1S/C12H11FN2O3/c1-17-12(16)9-6-5-8(18-9)7-14-11-4-2-3-10(13)15-11/h2-6H,7H2,1H3,(H,14,15) |
| InChIKey | FJJJRUHMEFHXTK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|