C13H10Cl2FNO3 — CID 107572628
methyl 5-[(3,5-dichloro-4-fluoroanilino)methyl]furan-2-carboxylate (PubChem CID 107572628) has the molecular formula C13H10Cl2FNO3 and a molecular weight of 318.13 g/mol. Its IUPAC name is methyl 5-[(3,5-dichloro-4-fluoroanilino)methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[(3,5-dichloro-4-fluoroanilino)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 107572628 |
| Molecular Formula | C13H10Cl2FNO3 |
| Molecular Weight | 318.13 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | methyl 5-[(3,5-dichloro-4-fluoroanilino)methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CNc2cc(Cl)c(F)c(Cl)c2)o1 |
| InChI | InChI=1S/C13H10Cl2FNO3/c1-19-13(18)11-3-2-8(20-11)6-17-7-4-9(14)12(16)10(15)5-7/h2-5,17H,6H2,1H3 |
| InChIKey | YEPRHSSKXULJCX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.13 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|