C15H12Cl2FNO2 — CID 107575639
2-[4-[(3,5-dichloro-4-fluoroanilino)methyl]phenyl]acetic acid (PubChem CID 107575639) has the molecular formula C15H12Cl2FNO2 and a molecular weight of 328.17 g/mol. Its IUPAC name is 2-[4-[(3,5-dichloro-4-fluoroanilino)methyl]phenyl]acetic acid.
| Compound Name | 2-[4-[(3,5-dichloro-4-fluoroanilino)methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 107575639 |
| Molecular Formula | C15H12Cl2FNO2 |
| Molecular Weight | 328.17 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 2-[4-[(3,5-dichloro-4-fluoroanilino)methyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(CNc2cc(Cl)c(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C15H12Cl2FNO2/c16-12-6-11(7-13(17)15(12)18)19-8-10-3-1-9(2-4-10)5-14(20)21/h1-4,6-7,19H,5,8H2,(H,20,21) |
| InChIKey | IDDGGHXBJUJUQS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.17 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|