C11H12Cl2FNO2 — CID 107573955
3-(3,5-dichloro-4-fluoroanilino)-2,2-dimethylpropanoic acid (PubChem CID 107573955) has the molecular formula C11H12Cl2FNO2 and a molecular weight of 280.13 g/mol. Its IUPAC name is 3-(3,5-dichloro-4-fluoroanilino)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(3,5-dichloro-4-fluoroanilino)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 107573955 |
| Molecular Formula | C11H12Cl2FNO2 |
| Molecular Weight | 280.13 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 3-(3,5-dichloro-4-fluoroanilino)-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(CNc1cc(Cl)c(F)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C11H12Cl2FNO2/c1-11(2,10(16)17)5-15-6-3-7(12)9(14)8(13)4-6/h3-4,15H,5H2,1-2H3,(H,16,17) |
| InChIKey | CFDZIRGERZDAHH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.13 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|