C11H10ClF3O2 — CID 117420467
3-(3-chloro-2,5,6-trifluorophenyl)-2,2-dimethylpropanoic acid (PubChem CID 117420467) has the molecular formula C11H10ClF3O2 and a molecular weight of 266.65 g/mol. Its IUPAC name is 3-(3-chloro-2,5,6-trifluorophenyl)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(3-chloro-2,5,6-trifluorophenyl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 117420467 |
| Molecular Formula | C11H10ClF3O2 |
| Molecular Weight | 266.65 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 3-(3-chloro-2,5,6-trifluorophenyl)-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(Cc1c(F)c(F)cc(Cl)c1F)C(=O)O |
| InChI | InChI=1S/C11H10ClF3O2/c1-11(2,10(16)17)4-5-8(14)6(12)3-7(13)9(5)15/h3H,4H2,1-2H3,(H,16,17) |
| InChIKey | RRWZUNDILKIMFE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.65 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|