C9H8ClF3 — CID 144809171
1-chloro-2,4,5-trifluoro-3-propylbenzene (PubChem CID 144809171) has the molecular formula C9H8ClF3 and a molecular weight of 208.61 g/mol. Its IUPAC name is 1-chloro-2,4,5-trifluoro-3-propylbenzene.
| Compound Name | 1-chloro-2,4,5-trifluoro-3-propylbenzene |
|---|---|
| PubChem CID | 144809171 |
| Molecular Formula | C9H8ClF3 |
| Molecular Weight | 208.61 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 1-chloro-2,4,5-trifluoro-3-propylbenzene |
| SMILES | CCCc1c(F)c(F)cc(Cl)c1F |
| InChI | InChI=1S/C9H8ClF3/c1-2-3-5-8(12)6(10)4-7(11)9(5)13/h4H,2-3H2,1H3 |
| InChIKey | KCYDUDMSQDTFTC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.61 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|