C9H9F4P — CID 166866100
(2,3,5,6-tetrafluoro-4-propylphenyl)phosphane (PubChem CID 166866100) has the molecular formula C9H9F4P and a molecular weight of 224.14 g/mol. Its IUPAC name is (2,3,5,6-tetrafluoro-4-propylphenyl)phosphane.
| Compound Name | (2,3,5,6-tetrafluoro-4-propylphenyl)phosphane |
|---|---|
| PubChem CID | 166866100 |
| Molecular Formula | C9H9F4P |
| Molecular Weight | 224.14 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | (2,3,5,6-tetrafluoro-4-propylphenyl)phosphane |
| SMILES | CCCc1c(F)c(F)c(P)c(F)c1F |
| InChI | InChI=1S/C9H9F4P/c1-2-3-4-5(10)7(12)9(14)8(13)6(4)11/h2-3,14H2,1H3 |
| InChIKey | AQOWUGOBFWGOLN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.14 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|