C11H10F4 — CID 168782513
1-ethenyl-2,3,5,6-tetrafluoro-4-propylbenzene (PubChem CID 168782513) has the molecular formula C11H10F4 and a molecular weight of 218.19 g/mol. Its IUPAC name is 1-ethenyl-2,3,5,6-tetrafluoro-4-propylbenzene.
| Compound Name | 1-ethenyl-2,3,5,6-tetrafluoro-4-propylbenzene |
|---|---|
| PubChem CID | 168782513 |
| Molecular Formula | C11H10F4 |
| Molecular Weight | 218.19 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 1-ethenyl-2,3,5,6-tetrafluoro-4-propylbenzene |
| SMILES | C=Cc1c(F)c(F)c(CCC)c(F)c1F |
| InChI | InChI=1S/C11H10F4/c1-3-5-7-10(14)8(12)6(4-2)9(13)11(7)15/h4H,2-3,5H2,1H3 |
| InChIKey | NPAYBMSUQUKFPS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.19 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|