C32H12BF16Na — CID 142744683
sodium tetrakis(4-ethenyl-2,3,5,6-tetrafluorophenyl)boranuide (PubChem CID 142744683) has the molecular formula C32H12BF16Na and a molecular weight of 734.22 g/mol. Its IUPAC name is sodium tetrakis(4-ethenyl-2,3,5,6-tetrafluorophenyl)boranuide.
| Compound Name | sodium tetrakis(4-ethenyl-2,3,5,6-tetrafluorophenyl)boranuide |
|---|---|
| PubChem CID | 142744683 |
| Molecular Formula | C32H12BF16Na |
| Molecular Weight | 734.22 g/mol |
| Exact Mass | 734.07 |
| IUPAC Name | sodium tetrakis(4-ethenyl-2,3,5,6-tetrafluorophenyl)boranuide |
| SMILES | C=Cc1c(F)c(F)c([B-](c2c(F)c(F)c(C=C)c(F)c2F)(c2c(F)c(F)c(C=C)c(F)c2F)c2c(F)c(F)c(C=C)c(F)c2F)c(F)c1F.[Na+] |
| InChI | InChI=1S/C32H12BF16.Na/c1-5-9-17(34)25(42)13(26(43)18(9)35)33(14-27(44)19(36)10(6-2)20(37)28(14)45,15-29(46)21(38)11(7-3)22(39)30(15)47)16-31(48)23(40)12(8-4)24(41)32(16)49;/h5-8H,1-4H2;/q-1;+1 |
| InChIKey | HSXSKUFZOAHHGR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.22 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|