C9H6F4O — CID 71669119
1-ethenyl-2,3,5,6-tetrafluoro-4-methoxybenzene (PubChem CID 71669119) has the molecular formula C9H6F4O and a molecular weight of 206.14 g/mol. Its IUPAC name is 1-ethenyl-2,3,5,6-tetrafluoro-4-methoxybenzene.
| Compound Name | 1-ethenyl-2,3,5,6-tetrafluoro-4-methoxybenzene |
|---|---|
| PubChem CID | 71669119 |
| Molecular Formula | C9H6F4O |
| Molecular Weight | 206.14 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 1-ethenyl-2,3,5,6-tetrafluoro-4-methoxybenzene |
| SMILES | C=Cc1c(F)c(F)c(OC)c(F)c1F |
| InChI | InChI=1S/C9H6F4O/c1-3-4-5(10)7(12)9(14-2)8(13)6(4)11/h3H,1H2,2H3 |
| InChIKey | TXDDBHZHCZRAJT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.14 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|