About 1-ethenyl-2,3,5,6-tetrafluoro-4-methoxybenzene
1-ethenyl-2,3,5,6-tetrafluoro-4-methoxybenzene (PubChem CID 71669119) has the molecular formula C9H6F4O
and a molecular weight of 206.14 g/mol. Its IUPAC name is 1-ethenyl-2,3,5,6-tetrafluoro-4-methoxybenzene.
Molecular Properties
| Compound Name | 1-ethenyl-2,3,5,6-tetrafluoro-4-methoxybenzene |
| PubChem CID | 71669119 |
| Molecular Formula | C9H6F4O |
| Molecular Weight | 206.14 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 1-ethenyl-2,3,5,6-tetrafluoro-4-methoxybenzene |
| SMILES | C=Cc1c(F)c(F)c(OC)c(F)c1F |
| InChI | InChI=1S/C9H6F4O/c1-3-4-5(10)7(12)9(14-2)8(13)6(4)11/h3H,1H2,2H3 |
| InChIKey | TXDDBHZHCZRAJT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.14 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-2,3,5,6-tetrafluoro-4-methoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-2,3,5,6-tetrafluoro-4-methoxybenzene?
The IUPAC name of 1-ethenyl-2,3,5,6-tetrafluoro-4-methoxybenzene (CID 71669119) is 1-ethenyl-2,3,5,6-tetrafluoro-4-methoxybenzene.
What is the SMILES notation for 1-ethenyl-2,3,5,6-tetrafluoro-4-methoxybenzene?
The canonical SMILES for 1-ethenyl-2,3,5,6-tetrafluoro-4-methoxybenzene is C=Cc1c(F)c(F)c(OC)c(F)c1F.
What is the InChIKey of 1-ethenyl-2,3,5,6-tetrafluoro-4-methoxybenzene?
The InChIKey is TXDDBHZHCZRAJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F4O/c1-3-4-5(10)7(12)9(14-2)8(13)6(4)11/h3H,1H2,2H3.
What are the key properties of 1-ethenyl-2,3,5,6-tetrafluoro-4-methoxybenzene?
1-ethenyl-2,3,5,6-tetrafluoro-4-methoxybenzene has a molecular weight of 206.14 g/mol, XLogP of 2.89, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2,3,5,6-tetrafluoro-4-methoxybenzene is sourced from PubChem (CID 71669119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).