C14H18F4OSi — CID 140747318
tert-butyl-(4-ethenyl-2,3,5,6-tetrafluorophenoxy)-dimethylsilane (PubChem CID 140747318) has the molecular formula C14H18F4OSi and a molecular weight of 306.38 g/mol. Its IUPAC name is tert-butyl-(4-ethenyl-2,3,5,6-tetrafluorophenoxy)-dimethylsilane.
| Compound Name | tert-butyl-(4-ethenyl-2,3,5,6-tetrafluorophenoxy)-dimethylsilane |
|---|---|
| PubChem CID | 140747318 |
| Molecular Formula | C14H18F4OSi |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | tert-butyl-(4-ethenyl-2,3,5,6-tetrafluorophenoxy)-dimethylsilane |
| SMILES | C=Cc1c(F)c(F)c(O[Si](C)(C)C(C)(C)C)c(F)c1F |
| InChI | InChI=1S/C14H18F4OSi/c1-7-8-9(15)11(17)13(12(18)10(8)16)19-20(5,6)14(2,3)4/h7H,1H2,2-6H3 |
| InChIKey | DHNYCXFEPKSUIS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|