C12H17ClF2OSi — CID 125115821
tert-butyl-(4-chloro-3,5-difluorophenoxy)-dimethylsilane (PubChem CID 125115821) has the molecular formula C12H17ClF2OSi and a molecular weight of 278.80 g/mol. Its IUPAC name is tert-butyl-(4-chloro-3,5-difluorophenoxy)-dimethylsilane.
| Compound Name | tert-butyl-(4-chloro-3,5-difluorophenoxy)-dimethylsilane |
|---|---|
| PubChem CID | 125115821 |
| Molecular Formula | C12H17ClF2OSi |
| Molecular Weight | 278.80 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | tert-butyl-(4-chloro-3,5-difluorophenoxy)-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cc(F)c(Cl)c(F)c1 |
| InChI | InChI=1S/C12H17ClF2OSi/c1-12(2,3)17(4,5)16-8-6-9(14)11(13)10(15)7-8/h6-7H,1-5H3 |
| InChIKey | AKGPNJVUBMGXRX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.80 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|