C12H20BClO3Si — CID 150229464
[3-[tert-butyl(dimethyl)silyl]oxy-5-chlorophenyl]boronic acid (PubChem CID 150229464) has the molecular formula C12H20BClO3Si and a molecular weight of 286.64 g/mol. Its IUPAC name is [3-[tert-butyl(dimethyl)silyl]oxy-5-chlorophenyl]boronic acid.
| Compound Name | [3-[tert-butyl(dimethyl)silyl]oxy-5-chlorophenyl]boronic acid |
|---|---|
| PubChem CID | 150229464 |
| Molecular Formula | C12H20BClO3Si |
| Molecular Weight | 286.64 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | [3-[tert-butyl(dimethyl)silyl]oxy-5-chlorophenyl]boronic acid |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cc(Cl)cc(B(O)O)c1 |
| InChI | InChI=1S/C12H20BClO3Si/c1-12(2,3)18(4,5)17-11-7-9(13(15)16)6-10(14)8-11/h6-8,15-16H,1-5H3 |
| InChIKey | FVEBEFBNDWBYFX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.64 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|